C17H16N6 — CID 2346353
2-[(1,3-diphenylpyrazol-4-yl)methylideneamino]guanidine (PubChem CID 2346353) has the molecular formula C17H16N6 and a molecular weight of 304.36 g/mol. Its IUPAC name is 2-[(1,3-diphenylpyrazol-4-yl)methylideneamino]guanidine.
| Compound Name | 2-[(1,3-diphenylpyrazol-4-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 2346353 |
| Molecular Formula | C17H16N6 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[(1,3-diphenylpyrazol-4-yl)methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H16N6/c18-17(19)21-20-11-14-12-23(15-9-5-2-6-10-15)22-16(14)13-7-3-1-4-8-13/h1-12H,(H4,18,19,21) |
| InChIKey | NMGWKCHTMNJLNC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|