C28H22N4 — CID 4605585
N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-N-phenylaniline (PubChem CID 4605585) has the molecular formula C28H22N4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-N-phenylaniline.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-N-phenylaniline |
|---|---|
| PubChem CID | 4605585 |
| Molecular Formula | C28H22N4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-N-phenylaniline |
| SMILES | C(=NN(c1ccccc1)c1ccccc1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H22N4/c1-5-13-23(14-6-1)28-24(22-31(30-28)25-15-7-2-8-16-25)21-29-32(26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-22H |
| InChIKey | CDEVQVNWRHOXEZ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|