C35H29N5SSi — CID 46933831
triphenylsilyl N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]carbamimidothioate (PubChem CID 46933831) has the molecular formula C35H29N5SSi and a molecular weight of 579.81 g/mol. Its IUPAC name is triphenylsilyl N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]carbamimidothioate.
| Compound Name | triphenylsilyl N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 46933831 |
| Molecular Formula | C35H29N5SSi |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | triphenylsilyl N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]carbamimidothioate |
| SMILES | N/C(=N/N=C/c1cn(-c2ccccc2)nc1-c1ccccc1)S[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H29N5SSi/c36-35(38-37-26-29-27-40(30-18-8-2-9-19-30)39-34(29)28-16-6-1-7-17-28)41-42(31-20-10-3-11-21-31,32-22-12-4-13-23-32)33-24-14-5-15-25-33/h1-27H,(H2,36,38)/b37-26+ |
| InChIKey | XKBAKVXHJXTKOT-AVLPFNLUSA-N |
| XLogP | 5.59 |
| TPSA | 68.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|