C23H21N5O — CID 21236377
(E)-N-(4,6-dimethylpyrimidin-2-yl)-1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanimine (PubChem CID 21236377) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is (E)-N-(4,6-dimethylpyrimidin-2-yl)-1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanimine.
| Compound Name | (E)-N-(4,6-dimethylpyrimidin-2-yl)-1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanimine |
|---|---|
| PubChem CID | 21236377 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (E)-N-(4,6-dimethylpyrimidin-2-yl)-1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanimine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/c2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C23H21N5O/c1-16-13-17(2)26-23(25-16)24-14-19-15-28(20-7-5-4-6-8-20)27-22(19)18-9-11-21(29-3)12-10-18/h4-15H,1-3H3/b24-14+ |
| InChIKey | RNPIHYDVHUHTJO-ZVHZXABRSA-N |
| XLogP | 4.71 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|