C26H23N5O3 — CID 3553633
N'-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-N-(3-methylphenyl)oxamide (PubChem CID 3553633) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is N'-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-N-(3-methylphenyl)oxamide.
| Compound Name | N'-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-N-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 3553633 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N'-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-N-(3-methylphenyl)oxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=NNC(=O)C(=O)Nc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C26H23N5O3/c1-18-7-6-8-21(15-18)28-25(32)26(33)29-27-16-20-17-31(22-9-4-3-5-10-22)30-24(20)19-11-13-23(34-2)14-12-19/h3-17H,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | CAEMEGVCPYXCRC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|