C29H30N4O4S — CID 23856063
1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-methoxy-2-piperidin-1-ylsulfonylphenyl)methanimine (PubChem CID 23856063) has the molecular formula C29H30N4O4S and a molecular weight of 530.65 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-methoxy-2-piperidin-1-ylsulfonylphenyl)methanimine.
| Compound Name | 1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-methoxy-2-piperidin-1-ylsulfonylphenyl)methanimine |
|---|---|
| PubChem CID | 23856063 |
| Molecular Formula | C29H30N4O4S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-methoxy-2-piperidin-1-ylsulfonylphenyl)methanimine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/c2ccc(OC)cc2S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C29H30N4O4S/c1-36-25-13-11-22(12-14-25)29-23(21-33(31-29)24-9-5-3-6-10-24)20-30-27-16-15-26(37-2)19-28(27)38(34,35)32-17-7-4-8-18-32/h3,5-6,9-16,19-21H,4,7-8,17-18H2,1-2H3/b30-20+ |
| InChIKey | RPWODPXMIKPYEE-TWKHWXDSSA-N |
| XLogP | 5.48 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|