C29H27F2N5O4S — CID 2356901
N-[[3-[4-(difluoromethoxy)phenyl]-1-phenylpyrazol-4-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 2356901) has the molecular formula C29H27F2N5O4S and a molecular weight of 579.63 g/mol. Its IUPAC name is N-[[3-[4-(difluoromethoxy)phenyl]-1-phenylpyrazol-4-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[[3-[4-(difluoromethoxy)phenyl]-1-phenylpyrazol-4-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2356901 |
| Molecular Formula | C29H27F2N5O4S |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | N-[[3-[4-(difluoromethoxy)phenyl]-1-phenylpyrazol-4-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NN=Cc1cn(-c2ccccc2)nc1-c1ccc(OC(F)F)cc1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C29H27F2N5O4S/c30-29(31)40-25-14-12-21(13-15-25)27-23(20-36(34-27)24-9-3-1-4-10-24)19-32-33-28(37)22-8-7-11-26(18-22)41(38,39)35-16-5-2-6-17-35/h1,3-4,7-15,18-20,29H,2,5-6,16-17H2,(H,33,37) |
| InChIKey | DVSULVNTCNMPOQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|