C30H24ClN5O4S — CID 6900956
3-[(2-chlorophenyl)sulfamoyl]-N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide (PubChem CID 6900956) has the molecular formula C30H24ClN5O4S and a molecular weight of 586.07 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfamoyl]-N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 3-[(2-chlorophenyl)sulfamoyl]-N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6900956 |
| Molecular Formula | C30H24ClN5O4S |
| Molecular Weight | 586.07 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfamoyl]-N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/NC(=O)c2cccc(S(=O)(=O)Nc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C30H24ClN5O4S/c1-40-25-16-14-21(15-17-25)29-23(20-36(34-29)24-9-3-2-4-10-24)19-32-33-30(37)22-8-7-11-26(18-22)41(38,39)35-28-13-6-5-12-27(28)31/h2-20,35H,1H3,(H,33,37)/b32-19+ |
| InChIKey | BPUGMVDOYKLDRW-BIZUNTBRSA-N |
| XLogP | 5.77 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.07 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|