C31H27N5O3S — CID 6270484
N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 6270484) has the molecular formula C31H27N5O3S and a molecular weight of 549.66 g/mol. Its IUPAC name is N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 6270484 |
| Molecular Formula | C31H27N5O3S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)c2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H27N5O3S/c1-22-8-12-24(13-9-22)30-26(21-36(34-30)28-6-4-3-5-7-28)20-32-33-31(37)25-14-16-27(17-15-25)35-40(38,39)29-18-10-23(2)11-19-29/h3-21,35H,1-2H3,(H,33,37)/b32-20- |
| InChIKey | ZQNVDYITTJOEQR-RGXNXFOYSA-N |
| XLogP | 5.72 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|