C17H12ClF3N4 — CID 9058452
N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-2,4-difluoroaniline (PubChem CID 9058452) has the molecular formula C17H12ClF3N4 and a molecular weight of 364.76 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-2,4-difluoroaniline.
| Compound Name | N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 9058452 |
| Molecular Formula | C17H12ClF3N4 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-2,4-difluoroaniline |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=N\Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H12ClF3N4/c1-10-14(9-22-23-16-7-4-12(20)8-15(16)21)17(18)25(24-10)13-5-2-11(19)3-6-13/h2-9,23H,1H3/b22-9- |
| InChIKey | IERQIXAXJMJAFW-AFPJDJCSSA-N |
| XLogP | 4.70 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|