C19H14ClFN6 — CID 7930139
N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]phthalazin-1-amine (PubChem CID 7930139) has the molecular formula C19H14ClFN6 and a molecular weight of 380.81 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]phthalazin-1-amine.
| Compound Name | N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]phthalazin-1-amine |
|---|---|
| PubChem CID | 7930139 |
| Molecular Formula | C19H14ClFN6 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]phthalazin-1-amine |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=N\Nc1nncc2ccccc12 |
| InChI | InChI=1S/C19H14ClFN6/c1-12-17(18(20)27(26-12)15-8-6-14(21)7-9-15)11-23-25-19-16-5-3-2-4-13(16)10-22-24-19/h2-11H,1H3,(H,24,25)/b23-11- |
| InChIKey | XEZMSNOLNYZVIR-KSEXSDGBSA-N |
| XLogP | 4.36 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|