C15H17ClFN5OS — CID 6892970
1-[(E)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2-methoxyethyl)thiourea (PubChem CID 6892970) has the molecular formula C15H17ClFN5OS and a molecular weight of 369.85 g/mol. Its IUPAC name is 1-[(E)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[(E)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 6892970 |
| Molecular Formula | C15H17ClFN5OS |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-[(E)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)N/N=C/c1c(C)nn(-c2ccc(F)cc2)c1Cl |
| InChI | InChI=1S/C15H17ClFN5OS/c1-10-13(9-19-20-15(24)18-7-8-23-2)14(16)22(21-10)12-5-3-11(17)4-6-12/h3-6,9H,7-8H2,1-2H3,(H2,18,20,24)/b19-9+ |
| InChIKey | NFOJYNMUDIJWOS-DJKKODMXSA-N |
| XLogP | 2.42 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|