C19H21ClFN3O4 — CID 8952965
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 8952965) has the molecular formula C19H21ClFN3O4 and a molecular weight of 409.85 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 8952965 |
| Molecular Formula | C19H21ClFN3O4 |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)/C=C/c1c(C)nn(-c2ccc(F)cc2)c1Cl |
| InChI | InChI=1S/C19H21ClFN3O4/c1-12-16(18(20)24(23-12)15-6-4-14(21)5-7-15)8-9-17(25)28-13(2)19(26)22-10-11-27-3/h4-9,13H,10-11H2,1-3H3,(H,22,26)/b9-8+/t13-/m0/s1 |
| InChIKey | GSTNAGPVPQQKFO-XEHSLEBBSA-N |
| XLogP | 2.68 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|