C20H19ClFN5S — CID 2444444
1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 2444444) has the molecular formula C20H19ClFN5S and a molecular weight of 415.93 g/mol. Its IUPAC name is 1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 2444444 |
| Molecular Formula | C20H19ClFN5S |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NN=Cc2c(C)nn(-c3ccc(F)cc3)c2Cl)c1 |
| InChI | InChI=1S/C20H19ClFN5S/c1-12-4-5-13(2)18(10-12)24-20(28)25-23-11-17-14(3)26-27(19(17)21)16-8-6-15(22)7-9-16/h4-11H,1-3H3,(H2,24,25,28) |
| InChIKey | USXQONZCWPSWSS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|