C22H21Cl2FN6O3S2 — CID 4019111
1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 4019111) has the molecular formula C22H21Cl2FN6O3S2 and a molecular weight of 571.49 g/mol. Its IUPAC name is 1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 4019111 |
| Molecular Formula | C22H21Cl2FN6O3S2 |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | 1-[[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C=NNC(=S)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C22H21Cl2FN6O3S2/c1-14-18(21(24)31(29-14)16-4-2-15(25)3-5-16)13-26-28-22(35)27-20-12-17(6-7-19(20)23)36(32,33)30-8-10-34-11-9-30/h2-7,12-13H,8-11H2,1H3,(H2,27,28,35) |
| InChIKey | JOBGBYZYPBRSGX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|