C22H25Cl2N5O4S2 — CID 3626659
1-[(2,4-dichlorophenyl)methylideneamino]-3-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 3626659) has the molecular formula C22H25Cl2N5O4S2 and a molecular weight of 558.51 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methylideneamino]-3-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-[(2,4-dichlorophenyl)methylideneamino]-3-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 3626659 |
| Molecular Formula | C22H25Cl2N5O4S2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methylideneamino]-3-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | O=S(=O)(c1ccc(N2CCOCC2)c(NC(=S)NN=Cc2ccc(Cl)cc2Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C22H25Cl2N5O4S2/c23-17-2-1-16(19(24)13-17)15-25-27-22(34)26-20-14-18(35(30,31)29-7-11-33-12-8-29)3-4-21(20)28-5-9-32-10-6-28/h1-4,13-15H,5-12H2,(H2,26,27,34) |
| InChIKey | WHAPQOCYEPBEBC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|