C22H27N5O7S2 — CID 136680662
1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(2,3,4-trihydroxyphenyl)methylideneamino]thiourea (PubChem CID 136680662) has the molecular formula C22H27N5O7S2 and a molecular weight of 537.62 g/mol. Its IUPAC name is 1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(2,3,4-trihydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(2,3,4-trihydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 136680662 |
| Molecular Formula | C22H27N5O7S2 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(2,3,4-trihydroxyphenyl)methylideneamino]thiourea |
| SMILES | O=S(=O)(c1ccc(N2CCOCC2)c(NC(=S)N/N=C\c2ccc(O)c(O)c2O)c1)N1CCOCC1 |
| InChI | InChI=1S/C22H27N5O7S2/c28-19-4-1-15(20(29)21(19)30)14-23-25-22(35)24-17-13-16(36(31,32)27-7-11-34-12-8-27)2-3-18(17)26-5-9-33-10-6-26/h1-4,13-14,28-30H,5-12H2,(H2,24,25,35)/b23-14- |
| InChIKey | DNBPCXNASNOZTO-UCQKPKSFSA-N |
| XLogP | 0.98 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|