C25H37N5O4S2 — CID 6151312
1-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-3-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 6151312) has the molecular formula C25H37N5O4S2 and a molecular weight of 535.74 g/mol. Its IUPAC name is 1-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-3-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-3-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 6151312 |
| Molecular Formula | C25H37N5O4S2 |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 1-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-3-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | CC(C)=CCC/C(C)=C/C=N\NC(=S)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C25H37N5O4S2/c1-20(2)5-4-6-21(3)9-10-26-28-25(35)27-23-19-22(36(31,32)30-13-17-34-18-14-30)7-8-24(23)29-11-15-33-16-12-29/h5,7-10,19H,4,6,11-18H2,1-3H3,(H2,27,28,35)/b21-9+,26-10- |
| InChIKey | XRALRFNLMUSQSX-PGFOLDSNSA-N |
| XLogP | 3.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|