C28H41N5O4S2 — CID 129379239
1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[(E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]thiourea (PubChem CID 129379239) has the molecular formula C28H41N5O4S2 and a molecular weight of 575.80 g/mol. Its IUPAC name is 1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[(E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]thiourea.
| Compound Name | 1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[(E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 129379239 |
| Molecular Formula | C28H41N5O4S2 |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[(E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]thiourea |
| SMILES | CC1=CCCC(C)(C)[C@H]1/C=C/C(C)=N\NC(=S)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C28H41N5O4S2/c1-21-6-5-11-28(3,4)24(21)9-7-22(2)30-31-27(38)29-25-20-23(39(34,35)33-14-18-37-19-15-33)8-10-26(25)32-12-16-36-17-13-32/h6-10,20,24H,5,11-19H2,1-4H3,(H2,29,31,38)/b9-7+,30-22-/t24-/m0/s1 |
| InChIKey | YBVIKHKBXOZYRH-BSMNVNHLSA-N |
| XLogP | 4.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|