C24H34N4O3S2 — CID 94844601
1-(4-morpholin-4-ylsulfonylphenyl)-3-[(E)-[(E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]thiourea (PubChem CID 94844601) has the molecular formula C24H34N4O3S2 and a molecular weight of 490.70 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(E)-[(E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]thiourea.
| Compound Name | 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(E)-[(E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 94844601 |
| Molecular Formula | C24H34N4O3S2 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(E)-[(E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]thiourea |
| SMILES | CC1=CCCC(C)(C)[C@H]1/C=C/C(C)=N/NC(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H34N4O3S2/c1-18-6-5-13-24(3,4)22(18)12-7-19(2)26-27-23(32)25-20-8-10-21(11-9-20)33(29,30)28-14-16-31-17-15-28/h6-12,22H,5,13-17H2,1-4H3,(H2,25,27,32)/b12-7+,26-19+/t22-/m0/s1 |
| InChIKey | XCWBXZVGTMUFMX-KIZVWGKPSA-N |
| XLogP | 4.31 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|