C20H26N2O2 — CID 7244982
2-hydroxy-N-[(E)-[(E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]benzamide (PubChem CID 7244982) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-[(E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]benzamide.
| Compound Name | 2-hydroxy-N-[(E)-[(E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 7244982 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-hydroxy-N-[(E)-[(E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]benzamide |
| SMILES | CC1=CCCC(C)(C)[C@@H]1/C=C/C(C)=N/NC(=O)c1ccccc1O |
| InChI | InChI=1S/C20H26N2O2/c1-14-8-7-13-20(3,4)17(14)12-11-15(2)21-22-19(24)16-9-5-6-10-18(16)23/h5-6,8-12,17,23H,7,13H2,1-4H3,(H,22,24)/b12-11+,21-15+/t17-/m1/s1 |
| InChIKey | RHZLVRODLZIBEW-IBEDIEBJSA-N |
| XLogP | 4.44 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|