C18H31NO — CID 44626454
(Z,E)-N-(3-methylbutoxy)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine (PubChem CID 44626454) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is (Z,E)-N-(3-methylbutoxy)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine.
| Compound Name | (Z,E)-N-(3-methylbutoxy)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine |
|---|---|
| PubChem CID | 44626454 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (Z,E)-N-(3-methylbutoxy)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(C)=N\OCCC(C)C |
| InChI | InChI=1S/C18H31NO/c1-14(2)11-13-20-19-16(4)9-10-17-15(3)8-7-12-18(17,5)6/h8-10,14,17H,7,11-13H2,1-6H3/b10-9+,19-16- |
| InChIKey | PVNGFTGBTBRPCK-NYSNFYRHSA-N |
| XLogP | 5.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|