About 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene
6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene (PubChem CID 54139758) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene.
Molecular Properties
| Compound Name | 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene |
| PubChem CID | 54139758 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene |
| SMILES | COC(C)C=CC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C14H24O/c1-11-7-6-10-14(3,4)13(11)9-8-12(2)15-5/h7-9,12-13H,6,10H2,1-5H3 |
| InChIKey | OAGOFXGDEYVFQB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene?
The IUPAC name of 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene (CID 54139758) is 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene.
What is the SMILES notation for 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene?
The canonical SMILES for 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene is COC(C)C=CC1C(C)=CCCC1(C)C.
What is the InChIKey of 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene?
The InChIKey is OAGOFXGDEYVFQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O/c1-11-7-6-10-14(3,4)13(11)9-8-12(2)15-5/h7-9,12-13H,6,10H2,1-5H3.
What are the key properties of 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene?
6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene has a molecular weight of 208.34 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methoxybut-1-enyl)-1,5,5-trimethylcyclohexene is sourced from PubChem (CID 54139758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).