C18H32N+ — CID 54537776
dimethyl-prop-2-enyl-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium (PubChem CID 54537776) has the molecular formula C18H32N+ and a molecular weight of 262.46 g/mol. Its IUPAC name is dimethyl-prop-2-enyl-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium.
| Compound Name | dimethyl-prop-2-enyl-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium |
|---|---|
| PubChem CID | 54537776 |
| Molecular Formula | C18H32N+ |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | dimethyl-prop-2-enyl-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium |
| SMILES | C=CC[N+](C)(C)C(C)C=CC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C18H32N/c1-8-14-19(6,7)16(3)11-12-17-15(2)10-9-13-18(17,4)5/h8,10-12,16-17H,1,9,13-14H2,2-7H3/q+1 |
| InChIKey | ZBAAGGMTFJOGKU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|