C17H26O — CID 11230369
(2E,4E)-3-propan-2-yl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dienal (PubChem CID 11230369) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (2E,4E)-3-propan-2-yl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dienal.
| Compound Name | (2E,4E)-3-propan-2-yl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dienal |
|---|---|
| PubChem CID | 11230369 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (2E,4E)-3-propan-2-yl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dienal |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(=C/C=O)C(C)C |
| InChI | InChI=1S/C17H26O/c1-13(2)15(10-12-18)8-9-16-14(3)7-6-11-17(16,4)5/h7-10,12-13,16H,6,11H2,1-5H3/b9-8+,15-10- |
| InChIKey | PJDUSCRLULZZOE-QCAIBQKMSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|