C16H30O2 — CID 70502775
6-[(E)-3-methoxybut-1-enyl]-1,5,5-trimethylcyclohexene;methoxymethane (PubChem CID 70502775) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 6-[(E)-3-methoxybut-1-enyl]-1,5,5-trimethylcyclohexene;methoxymethane.
| Compound Name | 6-[(E)-3-methoxybut-1-enyl]-1,5,5-trimethylcyclohexene;methoxymethane |
|---|---|
| PubChem CID | 70502775 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 6-[(E)-3-methoxybut-1-enyl]-1,5,5-trimethylcyclohexene;methoxymethane |
| SMILES | COC.COC(C)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C14H24O.C2H6O/c1-11-7-6-10-14(3,4)13(11)9-8-12(2)15-5;1-3-2/h7-9,12-13H,6,10H2,1-5H3;1-2H3/b9-8+; |
| InChIKey | FGUUPEOUHZVLSB-HRNDJLQDSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|