C15H24O — CID 141385053
6-(4-methoxy-3-methylbuta-1,3-dienyl)-1,5,5-trimethylcyclohexene (PubChem CID 141385053) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 6-(4-methoxy-3-methylbuta-1,3-dienyl)-1,5,5-trimethylcyclohexene.
| Compound Name | 6-(4-methoxy-3-methylbuta-1,3-dienyl)-1,5,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 141385053 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 6-(4-methoxy-3-methylbuta-1,3-dienyl)-1,5,5-trimethylcyclohexene |
| SMILES | COC=C(C)C=CC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C15H24O/c1-12(11-16-5)8-9-14-13(2)7-6-10-15(14,3)4/h7-9,11,14H,6,10H2,1-5H3 |
| InChIKey | GTCYGTCMWDIFLI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|