C22H28O3 — CID 11638681
(1E,4E)-1-(3,4-dimethoxyphenyl)-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one (PubChem CID 11638681) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (1E,4E)-1-(3,4-dimethoxyphenyl)-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(3,4-dimethoxyphenyl)-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 11638681 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (1E,4E)-1-(3,4-dimethoxyphenyl)-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(/C=C/C(=O)/C=C/C2C(C)=CCCC2(C)C)cc1OC |
| InChI | InChI=1S/C22H28O3/c1-16-7-6-14-22(2,3)19(16)12-11-18(23)10-8-17-9-13-20(24-4)21(15-17)25-5/h7-13,15,19H,6,14H2,1-5H3/b10-8+,12-11+ |
| InChIKey | BJTNIMQOXNLZJY-REVVXPLQSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|