C22H30O4 — CID 100994580
(2E,4E,6E,8E)-2-methoxycarbonyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraenoic acid (PubChem CID 100994580) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2E,4E,6E,8E)-2-methoxycarbonyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E,8E)-2-methoxycarbonyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 100994580 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (2E,4E,6E,8E)-2-methoxycarbonyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraenoic acid |
| SMILES | COC(=O)/C(C(=O)O)=C(C)/C=C/C=C(C)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C22H30O4/c1-15(12-13-18-16(2)11-8-14-22(18,4)5)9-7-10-17(3)19(20(23)24)21(25)26-6/h7,9-13,18H,8,14H2,1-6H3,(H,23,24)/b10-7+,13-12+,15-9+,19-17+ |
| InChIKey | CYCPXPBVIMJLIM-PEYMNDMMSA-N |
| XLogP | 5.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|