C19H24IN — CID 11326830
(2E,4E,6E,8E)-7-iodo-3-methyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraenenitrile (PubChem CID 11326830) has the molecular formula C19H24IN and a molecular weight of 393.31 g/mol. Its IUPAC name is (2E,4E,6E,8E)-7-iodo-3-methyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraenenitrile.
| Compound Name | (2E,4E,6E,8E)-7-iodo-3-methyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraenenitrile |
|---|---|
| PubChem CID | 11326830 |
| Molecular Formula | C19H24IN |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (2E,4E,6E,8E)-7-iodo-3-methyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraenenitrile |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(I)=C\C=C\C(C)=C\C#N |
| InChI | InChI=1S/C19H24IN/c1-15(12-14-21)7-5-9-17(20)10-11-18-16(2)8-6-13-19(18,3)4/h5,7-12,18H,6,13H2,1-4H3/b7-5+,11-10+,15-12+,17-9+ |
| InChIKey | PMMXLUVNWKXBRI-XVYSPDODSA-N |
| XLogP | 6.27 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|