About (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol
(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol (PubChem CID 21388154) has the molecular formula C13H22S
and a molecular weight of 210.39 g/mol. Its IUPAC name is (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol.
Molecular Properties
| Compound Name | (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol |
| PubChem CID | 21388154 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(C)S |
| InChI | InChI=1S/C13H22S/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h6-8,11-12,14H,5,9H2,1-4H3/b8-7+ |
| InChIKey | BCAGCSGYBGVOPA-BQYQJAHWSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol?
The IUPAC name of (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol (CID 21388154) is (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol.
What is the SMILES notation for (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol?
The canonical SMILES for (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol is CC1=CCCC(C)(C)C1/C=C/C(C)S.
What is the InChIKey of (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol?
The InChIKey is BCAGCSGYBGVOPA-BQYQJAHWSA-N. The full InChI is InChI=1S/C13H22S/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h6-8,11-12,14H,5,9H2,1-4H3/b8-7+.
What are the key properties of (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol?
(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol has a molecular weight of 210.39 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-ene-2-thiol is sourced from PubChem (CID 21388154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).