C30H46O3P+ — CID 174755153
bis[3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dienoxy]-oxophosphanium (PubChem CID 174755153) has the molecular formula C30H46O3P+ and a molecular weight of 485.67 g/mol. Its IUPAC name is bis[3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dienoxy]-oxophosphanium.
| Compound Name | bis[3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dienoxy]-oxophosphanium |
|---|---|
| PubChem CID | 174755153 |
| Molecular Formula | C30H46O3P+ |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | bis[3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-1,4-dienoxy]-oxophosphanium |
| SMILES | CC1=CCCC(C)(C)C1C=CC(C)C=CO[P+](=O)OC=CC(C)C=CC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C30H46O3P/c1-23(13-15-27-25(3)11-9-19-29(27,5)6)17-21-32-34(31)33-22-18-24(2)14-16-28-26(4)12-10-20-30(28,7)8/h11-18,21-24,27-28H,9-10,19-20H2,1-8H3/q+1 |
| InChIKey | UWTMQIVKHKZLKN-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|