C20H27N3O — CID 40539368
1-phenyl-3-[(Z)-[(E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]urea (PubChem CID 40539368) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-phenyl-3-[(Z)-[(E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]urea.
| Compound Name | 1-phenyl-3-[(Z)-[(E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]urea |
|---|---|
| PubChem CID | 40539368 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-phenyl-3-[(Z)-[(E)-4-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-ylidene]amino]urea |
| SMILES | CC1=CCCC(C)(C)[C@@H]1/C=C/C(C)=N\NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H27N3O/c1-15-9-8-14-20(3,4)18(15)13-12-16(2)22-23-19(24)21-17-10-6-5-7-11-17/h5-7,9-13,18H,8,14H2,1-4H3,(H2,21,23,24)/b13-12+,22-16-/t18-/m1/s1 |
| InChIKey | UVFFBWUHUQKZPG-HOLQBUJASA-N |
| XLogP | 5.12 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|