C22H27N3O — CID 3478017
N-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ylideneamino]-1H-indole-3-carboxamide (PubChem CID 3478017) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 3478017 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ylideneamino]-1H-indole-3-carboxamide |
| SMILES | CC1=CCCC(C)(C)C1C=CC(C)=NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H27N3O/c1-15-8-7-13-22(3,4)19(15)12-11-16(2)24-25-21(26)18-14-23-20-10-6-5-9-17(18)20/h5-6,8-12,14,19,23H,7,13H2,1-4H3,(H,25,26) |
| InChIKey | URTXDKJXOBFYFB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|