C19H17N3O — CID 92957541
N-[(E)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1H-indole-3-carboxamide (PubChem CID 92957541) has the molecular formula C19H17N3O and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[(E)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1H-indole-3-carboxamide.
| Compound Name | N-[(E)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 92957541 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[(E)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1H-indole-3-carboxamide |
| SMILES | CC(=C/c1ccccc1)/C=N/NC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N3O/c1-14(11-15-7-3-2-4-8-15)12-21-22-19(23)17-13-20-18-10-6-5-9-16(17)18/h2-13,20H,1H3,(H,22,23)/b14-11-,21-12+ |
| InChIKey | HZGCAELCWCWMJJ-HWQXQVJZSA-N |
| XLogP | 3.99 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|