C17H14Cl2N2O — CID 3752825
2,4-dichloro-N-[(2-methyl-3-phenylprop-2-enylidene)amino]benzamide (PubChem CID 3752825) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2-methyl-3-phenylprop-2-enylidene)amino]benzamide.
| Compound Name | 2,4-dichloro-N-[(2-methyl-3-phenylprop-2-enylidene)amino]benzamide |
|---|---|
| PubChem CID | 3752825 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2,4-dichloro-N-[(2-methyl-3-phenylprop-2-enylidene)amino]benzamide |
| SMILES | CC(C=NNC(=O)c1ccc(Cl)cc1Cl)=Cc1ccccc1 |
| InChI | InChI=1S/C17H14Cl2N2O/c1-12(9-13-5-3-2-4-6-13)11-20-21-17(22)15-8-7-14(18)10-16(15)19/h2-11H,1H3,(H,21,22) |
| InChIKey | XXAOIPTVDRGEBS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|