C16H13Cl2NO3S — CID 69432024
2,4-dichloro-N-[(Z)-1-phenylprop-1-en-2-yl]sulfonylbenzamide (PubChem CID 69432024) has the molecular formula C16H13Cl2NO3S and a molecular weight of 370.26 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-1-phenylprop-1-en-2-yl]sulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-1-phenylprop-1-en-2-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 69432024 |
| Molecular Formula | C16H13Cl2NO3S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-1-phenylprop-1-en-2-yl]sulfonylbenzamide |
| SMILES | C/C(=C/c1ccccc1)S(=O)(=O)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2NO3S/c1-11(9-12-5-3-2-4-6-12)23(21,22)19-16(20)14-8-7-13(17)10-15(14)18/h2-10H,1H3,(H,19,20)/b11-9- |
| InChIKey | RKYYKHAPRUVSBD-LUAWRHEFSA-N |
| XLogP | 4.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |