C19H29N3O6S — CID 56502010
3-ethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 56502010) has the molecular formula C19H29N3O6S and a molecular weight of 427.52 g/mol. Its IUPAC name is 3-ethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | 3-ethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 56502010 |
| Molecular Formula | C19H29N3O6S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 3-ethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | CCOCCC(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H29N3O6S/c1-2-26-10-5-19(23)20-17-15-16(29(24,25)22-8-13-28-14-9-22)3-4-18(17)21-6-11-27-12-7-21/h3-4,15H,2,5-14H2,1H3,(H,20,23) |
| InChIKey | MWDLVJNAKIWYKB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|