C22H33N3O7S — CID 55753197
N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-(oxolan-2-ylmethoxy)propanamide (PubChem CID 55753197) has the molecular formula C22H33N3O7S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 55753197 |
| Molecular Formula | C22H33N3O7S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-(oxolan-2-ylmethoxy)propanamide |
| SMILES | O=C(CCOCC1CCCO1)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C22H33N3O7S/c26-22(5-11-31-17-18-2-1-10-32-18)23-20-16-19(33(27,28)25-8-14-30-15-9-25)3-4-21(20)24-6-12-29-13-7-24/h3-4,16,18H,1-2,5-15,17H2,(H,23,26) |
| InChIKey | JHRVRIMYPRKDPU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|