C17H26N4O5S — CID 119266422
2-amino-N-[5-morpholin-4-ylsulfonyl-2-(oxolan-2-ylmethylamino)phenyl]acetamide (PubChem CID 119266422) has the molecular formula C17H26N4O5S and a molecular weight of 398.49 g/mol. Its IUPAC name is 2-amino-N-[5-morpholin-4-ylsulfonyl-2-(oxolan-2-ylmethylamino)phenyl]acetamide.
| Compound Name | 2-amino-N-[5-morpholin-4-ylsulfonyl-2-(oxolan-2-ylmethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 119266422 |
| Molecular Formula | C17H26N4O5S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-amino-N-[5-morpholin-4-ylsulfonyl-2-(oxolan-2-ylmethylamino)phenyl]acetamide |
| SMILES | NCC(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1NCC1CCCO1 |
| InChI | InChI=1S/C17H26N4O5S/c18-11-17(22)20-16-10-14(27(23,24)21-5-8-25-9-6-21)3-4-15(16)19-12-13-2-1-7-26-13/h3-4,10,13,19H,1-2,5-9,11-12,18H2,(H,20,22) |
| InChIKey | JXYOJAQNAQIRET-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |