C22H33N3O5S — CID 42948457
N-[5-morpholin-4-ylsulfonyl-2-(oxolan-2-ylmethylamino)phenyl]cyclohexanecarboxamide (PubChem CID 42948457) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[5-morpholin-4-ylsulfonyl-2-(oxolan-2-ylmethylamino)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[5-morpholin-4-ylsulfonyl-2-(oxolan-2-ylmethylamino)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42948457 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-[5-morpholin-4-ylsulfonyl-2-(oxolan-2-ylmethylamino)phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1NCC1CCCO1)C1CCCCC1 |
| InChI | InChI=1S/C22H33N3O5S/c26-22(17-5-2-1-3-6-17)24-21-15-19(31(27,28)25-10-13-29-14-11-25)8-9-20(21)23-16-18-7-4-12-30-18/h8-9,15,17-18,23H,1-7,10-14,16H2,(H,24,26) |
| InChIKey | WWFHWLWGLPRALX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |