C19H32N4O6S2 — CID 25347481
4-[3-(diethylsulfamoylamino)-4-[[(2R)-oxolan-2-yl]methylamino]phenyl]sulfonylmorpholine (PubChem CID 25347481) has the molecular formula C19H32N4O6S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 4-[3-(diethylsulfamoylamino)-4-[[(2R)-oxolan-2-yl]methylamino]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-(diethylsulfamoylamino)-4-[[(2R)-oxolan-2-yl]methylamino]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 25347481 |
| Molecular Formula | C19H32N4O6S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 4-[3-(diethylsulfamoylamino)-4-[[(2R)-oxolan-2-yl]methylamino]phenyl]sulfonylmorpholine |
| SMILES | CCN(CC)S(=O)(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1NC[C@H]1CCCO1 |
| InChI | InChI=1S/C19H32N4O6S2/c1-3-22(4-2)31(26,27)21-19-14-17(30(24,25)23-9-12-28-13-10-23)7-8-18(19)20-15-16-6-5-11-29-16/h7-8,14,16,20-21H,3-6,9-13,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | ISCGNQTWLTYJRA-MRXNPFEDSA-N |
| XLogP | 1.30 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |