C20H25N3O6S — CID 51933841
N-[5-morpholin-4-ylsulfonyl-2-[[(2R)-oxolan-2-yl]methylamino]phenyl]furan-2-carboxamide (PubChem CID 51933841) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is N-[5-morpholin-4-ylsulfonyl-2-[[(2R)-oxolan-2-yl]methylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[5-morpholin-4-ylsulfonyl-2-[[(2R)-oxolan-2-yl]methylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51933841 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[5-morpholin-4-ylsulfonyl-2-[[(2R)-oxolan-2-yl]methylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1NC[C@H]1CCCO1)c1ccco1 |
| InChI | InChI=1S/C20H25N3O6S/c24-20(19-4-2-10-29-19)22-18-13-16(30(25,26)23-7-11-27-12-8-23)5-6-17(18)21-14-15-3-1-9-28-15/h2,4-6,10,13,15,21H,1,3,7-9,11-12,14H2,(H,22,24)/t15-/m1/s1 |
| InChIKey | VAQDUBSKXLYBLD-OAHLLOKOSA-N |
| XLogP | 2.14 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |