C20H31N3O5S — CID 26289530
N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)hexanamide (PubChem CID 26289530) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)hexanamide.
| Compound Name | N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)hexanamide |
|---|---|
| PubChem CID | 26289530 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)hexanamide |
| SMILES | CCCCCC(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H31N3O5S/c1-2-3-4-5-20(24)21-18-16-17(29(25,26)23-10-14-28-15-11-23)6-7-19(18)22-8-12-27-13-9-22/h6-7,16H,2-5,8-15H2,1H3,(H,21,24) |
| InChIKey | SUIMKPDCRNCJSB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|