C20H21ClF2N4O4S2 — CID 6107310
1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-1-[2-(difluoromethoxy)phenyl]ethylideneamino]thiourea (PubChem CID 6107310) has the molecular formula C20H21ClF2N4O4S2 and a molecular weight of 519.00 g/mol. Its IUPAC name is 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-1-[2-(difluoromethoxy)phenyl]ethylideneamino]thiourea.
| Compound Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-1-[2-(difluoromethoxy)phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 6107310 |
| Molecular Formula | C20H21ClF2N4O4S2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(Z)-1-[2-(difluoromethoxy)phenyl]ethylideneamino]thiourea |
| SMILES | C/C(=N/NC(=S)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl)c1ccccc1OC(F)F |
| InChI | InChI=1S/C20H21ClF2N4O4S2/c1-13(15-4-2-3-5-18(15)31-19(22)23)25-26-20(32)24-17-12-14(6-7-16(17)21)33(28,29)27-8-10-30-11-9-27/h2-7,12,19H,8-11H2,1H3,(H2,24,26,32)/b25-13- |
| InChIKey | HKXJPMJLYJYJOC-MXAYSNPKSA-N |
| XLogP | 3.67 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|