C16H21ClN4O6S — CID 108520247
N-(2-acetamidoethyl)-N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)oxamide (PubChem CID 108520247) has the molecular formula C16H21ClN4O6S and a molecular weight of 432.89 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)oxamide.
| Compound Name | N-(2-acetamidoethyl)-N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)oxamide |
|---|---|
| PubChem CID | 108520247 |
| Molecular Formula | C16H21ClN4O6S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-(2-acetamidoethyl)-N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)oxamide |
| SMILES | CC(=O)NCCNC(=O)C(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C16H21ClN4O6S/c1-11(22)18-4-5-19-15(23)16(24)20-14-10-12(2-3-13(14)17)28(25,26)21-6-8-27-9-7-21/h2-3,10H,4-9H2,1H3,(H,18,22)(H,19,23)(H,20,24) |
| InChIKey | JSYNPFQNZCVISJ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|