C18H24ClN3O5S — CID 108792177
1-acetyl-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)piperidine-4-carboxamide (PubChem CID 108792177) has the molecular formula C18H24ClN3O5S and a molecular weight of 429.93 g/mol. Its IUPAC name is 1-acetyl-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108792177 |
| Molecular Formula | C18H24ClN3O5S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 1-acetyl-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H24ClN3O5S/c1-13(23)21-6-4-14(5-7-21)18(24)20-17-12-15(2-3-16(17)19)28(25,26)22-8-10-27-11-9-22/h2-3,12,14H,4-11H2,1H3,(H,20,24) |
| InChIKey | KNDIGHRGCYUVCY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |