C18H24ClN3O4S — CID 9460845
1-acetyl-N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)piperidine-4-carboxamide (PubChem CID 9460845) has the molecular formula C18H24ClN3O4S and a molecular weight of 413.93 g/mol. Its IUPAC name is 1-acetyl-N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9460845 |
| Molecular Formula | C18H24ClN3O4S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-acetyl-N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)Nc2cc(S(=O)(=O)N3CCCC3)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H24ClN3O4S/c1-13(23)21-10-6-14(7-11-21)18(24)20-17-12-15(4-5-16(17)19)27(25,26)22-8-2-3-9-22/h4-5,12,14H,2-3,6-11H2,1H3,(H,20,24) |
| InChIKey | CYMSMNMJPOKBDH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |