C26H22ClN5 — CID 44715087
N-[(E)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]acridin-9-amine (PubChem CID 44715087) has the molecular formula C26H22ClN5 and a molecular weight of 439.95 g/mol. Its IUPAC name is N-[(E)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]acridin-9-amine.
| Compound Name | N-[(E)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]acridin-9-amine |
|---|---|
| PubChem CID | 44715087 |
| Molecular Formula | C26H22ClN5 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[(E)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]acridin-9-amine |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1/C=N/Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C26H22ClN5/c1-17-22(18(2)32(31-17)16-19-9-3-6-12-23(19)27)15-28-30-26-20-10-4-7-13-24(20)29-25-14-8-5-11-21(25)26/h3-15H,16H2,1-2H3,(H,29,30)/b28-15+ |
| InChIKey | YVWPAUWDCXVQJT-RWPZCVJISA-N |
| XLogP | 6.35 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|