About 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol (PubChem CID 134612814) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol |
| PubChem CID | 134612814 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1/C=N/C(C)(C)CO |
| InChI | InChI=1S/C17H23N3O/c1-13-16(10-18-17(3,4)12-21)14(2)20(19-13)11-15-8-6-5-7-9-15/h5-10,21H,11-12H2,1-4H3/b18-10+ |
| InChIKey | XGUZAXSQYMHFHH-VCHYOVAHSA-N |
| XLogP | 2.74 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol?
The IUPAC name of 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol (CID 134612814) is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol.
What is the SMILES notation for 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol?
The canonical SMILES for 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol is Cc1nn(Cc2ccccc2)c(C)c1/C=N/C(C)(C)CO.
What is the InChIKey of 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol?
The InChIKey is XGUZAXSQYMHFHH-VCHYOVAHSA-N. The full InChI is InChI=1S/C17H23N3O/c1-13-16(10-18-17(3,4)12-21)14(2)20(19-13)11-15-8-6-5-7-9-15/h5-10,21H,11-12H2,1-4H3/b18-10+.
What are the key properties of 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol?
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol has a molecular weight of 285.39 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropan-1-ol is sourced from PubChem (CID 134612814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).